Products 2305255-65-4

CAS 2305255-65-4 is the registry number for 3-(Aminomethyl)azetidine-1-sulfonyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(aminomethyl)azetidine-1-sulfonyl fluoride (CAS 2305255-65-4) is a chemical compound with the molecular formula C4H9FN2O2S and a molecular weight of 168.19 g/mol. IUPAC name: 3-(aminomethyl)azetidine-1-sulfonyl fluoride. InChIKey: WWIKIQPXXNVJCK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H9FN2O2S
Molecular weight168.19 g/mol
IUPAC name3-(aminomethyl)azetidine-1-sulfonyl fluoride
InChIKeyWWIKIQPXXNVJCK-UHFFFAOYSA-N
SMILESC1C(CN1S(=O)(=O)F)CN

Computed by PubChem (NCBI)