CAS 2305627-38-5 is the registry number for Lithium(1+) ion 4-(methoxycarbonyl)-2,5-dihydrothiophen-3-olate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Lithium 4-methoxycarbonyl-2,5-dihydrothiophen-3-olate (CAS 2305627-38-5) is a chemical compound with the molecular formula C6H7LiO3S and a molecular weight of 166.2 g/mol. IUPAC name: lithium 4-methoxycarbonyl-2,5-dihydrothiophen-3-olate. InChIKey: TUNYRUJMEXZOSM-UHFFFAOYSA-M.
| Molecular formula | C6H7LiO3S |
|---|---|
| Molecular weight | 166.2 g/mol |
| IUPAC name | lithium 4-methoxycarbonyl-2,5-dihydrothiophen-3-olate |
| InChIKey | TUNYRUJMEXZOSM-UHFFFAOYSA-M |
| SMILES | [Li+].COC(=O)C1=C(CSC1)[O-] |
Computed by PubChem (NCBI)