CAS 2305665-16-9 appears in our catalog under these names: Bis(butoxyethyl) Phosphate-d8, >95% (HPLC), Bis(butoxyethyl) phosphate-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
Bis(2-butoxy-1,1,2,2-tetradeuterioethyl) hydrogen phosphate (CAS 2305665-16-9) is a chemical compound with the molecular formula C12H27O6P and a molecular weight of 306.36 g/mol. IUPAC name: bis(2-butoxy-1,1,2,2-tetradeuterioethyl) hydrogen phosphate. InChIKey: NNXWIPHZHATIFE-PMCMNDOISA-N.
| Molecular formula | C12H27O6P |
|---|---|
| Molecular weight | 306.36 g/mol |
| IUPAC name | bis(2-butoxy-1,1,2,2-tetradeuterioethyl) hydrogen phosphate |
| InChIKey | NNXWIPHZHATIFE-PMCMNDOISA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OP(=O)(O)OC([2H])([2H])C([2H])([2H])OCCCC)OCCCC |
Computed by PubChem (NCBI)