CAS 2305789-66-4 is the registry number for ASM-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(4-bromophenyl)-1-(4-chlorophenyl)-N-hydroxypyrazole-3-carboxamide (CAS 2305789-66-4) is a chemical compound with the molecular formula C16H11BrClN3O2 and a molecular weight of 392.63 g/mol. IUPAC name: 5-(4-bromophenyl)-1-(4-chlorophenyl)-N-hydroxypyrazole-3-carboxamide. InChIKey: BWHLCGVVTKWFAA-UHFFFAOYSA-N.
| Molecular formula | C16H11BrClN3O2 |
|---|---|
| Molecular weight | 392.63 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1-(4-chlorophenyl)-N-hydroxypyrazole-3-carboxamide |
| InChIKey | BWHLCGVVTKWFAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NN2C3=CC=C(C=C3)Cl)C(=O)NO)Br |
Computed by PubChem (NCBI)