Products 2305793-87-5
CAS 2305793-87-5 appears in our catalog under these names: 4,4'-(Naphthalene-1,4-diyl)dibenzoic acid, 95%, 4,4′-(1,4-Naphthalenediyl)bis[benzoic acid], 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
4-[4-(4-carboxyphenyl)naphthalen-1-yl]benzoic acid (CAS 2305793-87-5) is a chemical compound with the molecular formula C24H16O4 and a molecular weight of 368.4 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)naphthalen-1-yl]benzoic acid. InChIKey: GDMVWZSWUNICCJ-UHFFFAOYSA-N.
| Molecular formula | C24H16O4 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)naphthalen-1-yl]benzoic acid |
| InChIKey | GDMVWZSWUNICCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C3=CC=C(C=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)