CAS 2305949-24-8 is the registry number for (Bis(dimethylamino)(oxo)-λâ¶-sulfanylidene)thiourea. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[bis(dimethylamino)-oxo-lambda6-sulfanylidene]thiourea (CAS 2305949-24-8) is a chemical compound with the molecular formula C5H14N4OS2 and a molecular weight of 210.3 g/mol. IUPAC name: [bis(dimethylamino)-oxo-lambda6-sulfanylidene]thiourea. InChIKey: RIQVYFWGIUOVFY-UHFFFAOYSA-N.
| Molecular formula | C5H14N4OS2 |
|---|---|
| Molecular weight | 210.3 g/mol |
| IUPAC name | [bis(dimethylamino)-oxo-lambda6-sulfanylidene]thiourea |
| InChIKey | RIQVYFWGIUOVFY-UHFFFAOYSA-N |
| SMILES | CN(C)S(=NC(=S)N)(=O)N(C)C |
Computed by PubChem (NCBI)