CAS 2305949-33-9 appears in our catalog under these names: (2-Chloro-5-iodophenyl)(2-ethoxyphenyl)methanone, 97%, Dapagliflozin Impurity 62, Dapagliflozin Impurity 17, Dapagliflozin Impurity 26. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2-chloro-5-iodophenyl)-(2-ethoxyphenyl)methanone (CAS 2305949-33-9) is a chemical compound with the molecular formula C15H12ClIO2 and a molecular weight of 386.61 g/mol. IUPAC name: (2-chloro-5-iodophenyl)-(2-ethoxyphenyl)methanone. InChIKey: NQSRSTKHQKSMGM-UHFFFAOYSA-N.
| Molecular formula | C15H12ClIO2 |
|---|---|
| Molecular weight | 386.61 g/mol |
| IUPAC name | (2-chloro-5-iodophenyl)-(2-ethoxyphenyl)methanone |
| InChIKey | NQSRSTKHQKSMGM-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1C(=O)C2=C(C=CC(=C2)I)Cl |
Computed by PubChem (NCBI)