Products 2306182-64-7
CAS 2306182-64-7 is the registry number for 3,7-Dihydro-5-(4-hydroxyphenyl)-7-phenyl-4H-pyrrolo[2,3-d]pyrimidin-4-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-(4-hydroxyphenyl)-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-4-one (CAS 2306182-64-7) is a chemical compound with the molecular formula C18H13N3O2 and a molecular weight of 303.3 g/mol. IUPAC name: 5-(4-hydroxyphenyl)-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-4-one. InChIKey: DJQCVFIMLKYVQV-UHFFFAOYSA-N.
| Molecular formula | C18H13N3O2 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 5-(4-hydroxyphenyl)-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| InChIKey | DJQCVFIMLKYVQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C3=C2N=CNC3=O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)