CAS 1423028-29-8 appears in our catalog under these names: 2-(1-Benzyl-1H-pyrazol-4-yl)-2,3-dihydro-1H-isoindole-1,3-dione, 95%, 2-(1-Benzyl-1H-pyrazol-4-yl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(1-benzylpyrazol-4-yl)isoindole-1,3-dione (CAS 1423028-29-8) is a chemical compound with the molecular formula C18H13N3O2 and a molecular weight of 303.3 g/mol. IUPAC name: 2-(1-benzylpyrazol-4-yl)isoindole-1,3-dione. InChIKey: XGSLFFUZXMQEMR-UHFFFAOYSA-N.
| Molecular formula | C18H13N3O2 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 2-(1-benzylpyrazol-4-yl)isoindole-1,3-dione |
| InChIKey | XGSLFFUZXMQEMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)N3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)