CAS 2306246-19-3 appears in our catalog under these names: trans-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole dihydrochloride, 95%, (3AR,6aR)-2-methyloctahydropyrrolo[3,4-c]pyrrole dihydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;dihydrochloride (CAS 2306246-19-3) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;dihydrochloride. InChIKey: NQSFFBGSZKBOTL-GPJOBVNKSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;dihydrochloride |
| InChIKey | NQSFFBGSZKBOTL-GPJOBVNKSA-N |
| SMILES | CN1C[C@H]2CNC[C@@H]2C1.Cl.Cl |
Computed by PubChem (NCBI)