Products 2306248-75-7
CAS 2306248-75-7 is the registry number for 3-(4,4-difluorocyclohexyl)propanal, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Trans-methyl (1R,3R)-3-fluorocyclopentane-1-carboxylate (CAS 2306248-75-7) is a chemical compound with the molecular formula C7H11FO2 and a molecular weight of 146.16 g/mol. IUPAC name: trans-methyl (1R,3R)-3-fluorocyclopentane-1-carboxylate. InChIKey: ZYRURXXPYRQMTJ-PHDIDXHHSA-N.
| Molecular formula | C7H11FO2 |
|---|---|
| Molecular weight | 146.16 g/mol |
| IUPAC name | trans-methyl (1R,3R)-3-fluorocyclopentane-1-carboxylate |
| InChIKey | ZYRURXXPYRQMTJ-PHDIDXHHSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@H](C1)F |
Computed by PubChem (NCBI)