CAS 2306252-27-5 is the registry number for (2S,4R)-tert-Butyl 4-(hydroxymethyl)-2-methylpyrrolidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (2S,4R)-4-(hydroxymethyl)-2-methylpyrrolidine-1-carboxylate (CAS 2306252-27-5) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (2S,4R)-4-(hydroxymethyl)-2-methylpyrrolidine-1-carboxylate. InChIKey: CCBKWUTWRPJIOE-DTWKUNHWSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (2S,4R)-4-(hydroxymethyl)-2-methylpyrrolidine-1-carboxylate |
| InChIKey | CCBKWUTWRPJIOE-DTWKUNHWSA-N |
| SMILES | C[C@H]1C[C@H](CN1C(=O)OC(C)(C)C)CO |
Computed by PubChem (NCBI)