Products 2306252-63-9
CAS 2306252-63-9 is the registry number for (2S,3S)-1,2-dimethylpiperidin-3-amine,dihydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(2S,3S)-1,2-dimethylpiperidin-3-amine;dihydrochloride (CAS 2306252-63-9) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (2S,3S)-1,2-dimethylpiperidin-3-amine;dihydrochloride. InChIKey: HXANKZDMOOTXLX-JFYKYWLVSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (2S,3S)-1,2-dimethylpiperidin-3-amine;dihydrochloride |
| InChIKey | HXANKZDMOOTXLX-JFYKYWLVSA-N |
| SMILES | C[C@H]1[C@H](CCCN1C)N.Cl.Cl |
Computed by PubChem (NCBI)