CAS 2306253-16-5 is the registry number for (1S,3S)-3-(Trifluoromethyl)-8-azaspiro[4.5]decan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,4S)-2-(trifluoromethyl)-8-azaspiro[4.5]decan-4-amine (CAS 2306253-16-5) is a chemical compound with the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. IUPAC name: (2S,4S)-2-(trifluoromethyl)-8-azaspiro[4.5]decan-4-amine. InChIKey: GJMREZOAPBMZLA-SFYZADRCSA-N.
| Molecular formula | C10H17F3N2 |
|---|---|
| Molecular weight | 222.25 g/mol |
| IUPAC name | (2S,4S)-2-(trifluoromethyl)-8-azaspiro[4.5]decan-4-amine |
| InChIKey | GJMREZOAPBMZLA-SFYZADRCSA-N |
| SMILES | C1CNCCC12C[C@@H](C[C@@H]2N)C(F)(F)F |
Computed by PubChem (NCBI)