CAS 2306255-12-7 is the registry number for Moxifloxacin Impurity 27 DiHCl. Offered by: Chemat Brand. Available pack sizes: on request.
(4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[3,4-b]pyridine;dihydrochloride (CAS 2306255-12-7) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[3,4-b]pyridine;dihydrochloride. InChIKey: PBDBVGLZVIIZNU-GPJOBVNKSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[3,4-b]pyridine;dihydrochloride |
| InChIKey | PBDBVGLZVIIZNU-GPJOBVNKSA-N |
| SMILES | C1C[C@@H]2CNC[C@H]2NC1.Cl.Cl |
Computed by PubChem (NCBI)