CAS 2306261-94-7 is the registry number for 4-bromo-7-iodo-(1,2)oxazolo(4,5-c)pyridin-3-amine, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
4-bromo-7-iodo-[1,2]oxazolo[4,5-c]pyridin-3-amine (CAS 2306261-94-7) is a chemical compound with the molecular formula C6H3BrIN3O and a molecular weight of 339.92 g/mol. IUPAC name: 4-bromo-7-iodo-[1,2]oxazolo[4,5-c]pyridin-3-amine. InChIKey: MPZXJYAORUYUNK-UHFFFAOYSA-N.
| Molecular formula | C6H3BrIN3O |
|---|---|
| Molecular weight | 339.92 g/mol |
| IUPAC name | 4-bromo-7-iodo-[1,2]oxazolo[4,5-c]pyridin-3-amine |
| InChIKey | MPZXJYAORUYUNK-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=NO2)N)C(=N1)Br)I |
Computed by PubChem (NCBI)