CAS 2306263-70-5 is the registry number for 4-Methoxytetrahydropyran-4-carboxylic Acid-d3. Offered by: TRC. Available pack sizes: 25mg.
4-(trideuteriomethoxy)oxane-4-carboxylic acid (CAS 2306263-70-5) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 163.19 g/mol. IUPAC name: 4-(trideuteriomethoxy)oxane-4-carboxylic acid. InChIKey: VJJYOPVQSMINBP-FIBGUPNXSA-N.
| Molecular formula | C7H12O4 |
|---|---|
| Molecular weight | 163.19 g/mol |
| IUPAC name | 4-(trideuteriomethoxy)oxane-4-carboxylic acid |
| InChIKey | VJJYOPVQSMINBP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1(CCOCC1)C(=O)O |
Computed by PubChem (NCBI)