Products 2306265-50-7
CAS 2306265-50-7 is the registry number for tert-Butyl 4-(bromomethyl)isoindoline-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl 4-(bromomethyl)-1,3-dihydroisoindole-2-carboxylate (CAS 2306265-50-7) is a chemical compound with the molecular formula C14H18BrNO2 and a molecular weight of 312.20 g/mol. IUPAC name: tert-butyl 4-(bromomethyl)-1,3-dihydroisoindole-2-carboxylate. InChIKey: RGMMAJGYYSGCAU-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO2 |
|---|---|
| Molecular weight | 312.20 g/mol |
| IUPAC name | tert-butyl 4-(bromomethyl)-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | RGMMAJGYYSGCAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C(=CC=C2)CBr |
Computed by PubChem (NCBI)