CAS 2306269-78-1 is the registry number for Piperidin-3-yl (4-chloro-3-fluorophenyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Piperidin-3-yl N-(4-chloro-3-fluorophenyl)carbamate (CAS 2306269-78-1) is a chemical compound with the molecular formula C12H14ClFN2O2 and a molecular weight of 272.70 g/mol. IUPAC name: piperidin-3-yl N-(4-chloro-3-fluorophenyl)carbamate. InChIKey: SBFDEAUAEOVRBF-UHFFFAOYSA-N.
| Molecular formula | C12H14ClFN2O2 |
|---|---|
| Molecular weight | 272.70 g/mol |
| IUPAC name | piperidin-3-yl N-(4-chloro-3-fluorophenyl)carbamate |
| InChIKey | SBFDEAUAEOVRBF-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)OC(=O)NC2=CC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)