CAS 2306269-79-2 is the registry number for Piperidin-3-yl (4-chloro-3-fluorophenyl)carbamate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Piperidin-3-yl N-(4-chloro-3-fluorophenyl)carbamate;hydrochloride (CAS 2306269-79-2) is a chemical compound with the molecular formula C12H15Cl2FN2O2 and a molecular weight of 309.16 g/mol. IUPAC name: piperidin-3-yl N-(4-chloro-3-fluorophenyl)carbamate;hydrochloride. InChIKey: GZFKIBNBHRTOEB-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2FN2O2 |
|---|---|
| Molecular weight | 309.16 g/mol |
| IUPAC name | piperidin-3-yl N-(4-chloro-3-fluorophenyl)carbamate;hydrochloride |
| InChIKey | GZFKIBNBHRTOEB-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)OC(=O)NC2=CC(=C(C=C2)Cl)F.Cl |
Computed by PubChem (NCBI)