CAS 2306269-89-4 is the registry number for tert-Butyl 2-(4-bromophenyl)-4-oxo-1,3,7-triazaspiro[4.4]non-1-ene-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-(4-bromophenyl)-4-oxo-1,3,7-triazaspiro[4.4]non-1-ene-7-carboxylate (CAS 2306269-89-4) is a chemical compound with the molecular formula C17H20BrN3O3 and a molecular weight of 394.3 g/mol. IUPAC name: tert-butyl 2-(4-bromophenyl)-4-oxo-1,3,7-triazaspiro[4.4]non-1-ene-7-carboxylate. InChIKey: XYTAAWKUDGBCBA-UHFFFAOYSA-N.
| Molecular formula | C17H20BrN3O3 |
|---|---|
| Molecular weight | 394.3 g/mol |
| IUPAC name | tert-butyl 2-(4-bromophenyl)-4-oxo-1,3,7-triazaspiro[4.4]non-1-ene-7-carboxylate |
| InChIKey | XYTAAWKUDGBCBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)C(=O)NC(=N2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)