Products 2306270-16-4
CAS 2306270-16-4 is the registry number for tert-Butyl 4-(4-chlorothieno[3,2-d]pyrimidin-6-yl)piperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(4-chlorothieno[3,2-d]pyrimidin-6-yl)piperidine-1-carboxylate (CAS 2306270-16-4) is a chemical compound with the molecular formula C16H20ClN3O2S and a molecular weight of 353.9 g/mol. IUPAC name: tert-butyl 4-(4-chlorothieno[3,2-d]pyrimidin-6-yl)piperidine-1-carboxylate. InChIKey: NYOSLNOFMBEHOY-UHFFFAOYSA-N.
| Molecular formula | C16H20ClN3O2S |
|---|---|
| Molecular weight | 353.9 g/mol |
| IUPAC name | tert-butyl 4-(4-chlorothieno[3,2-d]pyrimidin-6-yl)piperidine-1-carboxylate |
| InChIKey | NYOSLNOFMBEHOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC3=C(S2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)