CAS 2306275-56-7 is the registry number for 4-(6-Ethyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(6-ethyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline (CAS 2306275-56-7) is a chemical compound with the molecular formula C13H19N3 and a molecular weight of 217.31 g/mol. IUPAC name: 4-(6-ethyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline. InChIKey: XVCICFJEQQPLAK-UHFFFAOYSA-N.
| Molecular formula | C13H19N3 |
|---|---|
| Molecular weight | 217.31 g/mol |
| IUPAC name | 4-(6-ethyl-2,6-diazaspiro[3.3]heptan-2-yl)aniline |
| InChIKey | XVCICFJEQQPLAK-UHFFFAOYSA-N |
| SMILES | CCN1CC2(C1)CN(C2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)