CAS 2306275-92-1 is the registry number for 6-(5-Bromo-2-ethylbenzyl)-2,3-dihydrobenzo[b][1,4]dioxine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-[(5-bromo-2-ethylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine (CAS 2306275-92-1) is a chemical compound with the molecular formula C17H17BrO2 and a molecular weight of 333.2 g/mol. IUPAC name: 6-[(5-bromo-2-ethylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine. InChIKey: LCLCGXGPSDSIGH-UHFFFAOYSA-N.
| Molecular formula | C17H17BrO2 |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 6-[(5-bromo-2-ethylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
| InChIKey | LCLCGXGPSDSIGH-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)Br)CC2=CC3=C(C=C2)OCCO3 |
Computed by PubChem (NCBI)