CAS 2306276-24-2 is the registry number for 6-(4-Bromobenzyl)-3-ethyl-7-methylimidazo[1,5-a]pyrazin-8(7H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-[(4-bromophenyl)methyl]-3-ethyl-7-methylimidazo[1,5-a]pyrazin-8-one (CAS 2306276-24-2) is a chemical compound with the molecular formula C16H16BrN3O and a molecular weight of 346.22 g/mol. IUPAC name: 6-[(4-bromophenyl)methyl]-3-ethyl-7-methylimidazo[1,5-a]pyrazin-8-one. InChIKey: UHFXEWQJAXHHGF-UHFFFAOYSA-N.
| Molecular formula | C16H16BrN3O |
|---|---|
| Molecular weight | 346.22 g/mol |
| IUPAC name | 6-[(4-bromophenyl)methyl]-3-ethyl-7-methylimidazo[1,5-a]pyrazin-8-one |
| InChIKey | UHFXEWQJAXHHGF-UHFFFAOYSA-N |
| SMILES | CCC1=NC=C2N1C=C(N(C2=O)C)CC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)