Products 2306277-07-4

CAS 2306277-07-4 is the registry number for 6-Chloro-7-fluoro-quinoxaline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

6-chloro-7-fluoroquinoxaline-2-carboxylic acid (CAS 2306277-07-4) is a chemical compound with the molecular formula C9H4ClFN2O2 and a molecular weight of 226.59 g/mol. IUPAC name: 6-chloro-7-fluoroquinoxaline-2-carboxylic acid. InChIKey: UBUFAMOQIVWKSY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4ClFN2O2
Molecular weight226.59 g/mol
IUPAC name6-chloro-7-fluoroquinoxaline-2-carboxylic acid
InChIKeyUBUFAMOQIVWKSY-UHFFFAOYSA-N
SMILESC1=C2C(=CC(=C1F)Cl)N=CC(=N2)C(=O)O

Computed by PubChem (NCBI)