Products 2306411-34-5
CAS 2306411-34-5 is the registry number for IDO1-IN-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[5-[(3-chlorobenzoyl)amino]-2-pyridinyl]-N-(4-fluorophenyl)oxetane-3-carboxamide (CAS 2306411-34-5) is a chemical compound with the molecular formula C22H17ClFN3O3 and a molecular weight of 425.8 g/mol. IUPAC name: 3-[5-[(3-chlorobenzoyl)amino]-2-pyridinyl]-N-(4-fluorophenyl)oxetane-3-carboxamide. InChIKey: WDEBRZXZAXYXPK-UHFFFAOYSA-N.
| Molecular formula | C22H17ClFN3O3 |
|---|---|
| Molecular weight | 425.8 g/mol |
| IUPAC name | 3-[5-[(3-chlorobenzoyl)amino]-2-pyridinyl]-N-(4-fluorophenyl)oxetane-3-carboxamide |
| InChIKey | WDEBRZXZAXYXPK-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=NC=C(C=C2)NC(=O)C3=CC(=CC=C3)Cl)C(=O)NC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)