CAS 23069-32-1 is the registry number for 1H,1H-Perfluoro-n-decyl methacrylate, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl 2-methylprop-2-enoate (CAS 23069-32-1) is a chemical compound with the molecular formula C14H7F19O2 and a molecular weight of 568.17 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl 2-methylprop-2-enoate. InChIKey: NSSMHXVPVQADLY-UHFFFAOYSA-N.
| Molecular formula | C14H7F19O2 |
|---|---|
| Molecular weight | 568.17 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl 2-methylprop-2-enoate |
| InChIKey | NSSMHXVPVQADLY-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)