CAS 23072-03-9 is the registry number for (2-Pyrrolidinylethyl)triphenylphosphonium Bromide. Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.
Triphenyl(2-pyrrolidin-1-ylethyl)phosphanium bromide (CAS 23072-03-9) is a chemical compound with the molecular formula C24H27BrNP and a molecular weight of 440.4 g/mol. IUPAC name: triphenyl(2-pyrrolidin-1-ylethyl)phosphanium bromide. InChIKey: HKLRVZSQJCQGQN-UHFFFAOYSA-M.
| Molecular formula | C24H27BrNP |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | triphenyl(2-pyrrolidin-1-ylethyl)phosphanium bromide |
| InChIKey | HKLRVZSQJCQGQN-UHFFFAOYSA-M |
| SMILES | C1CCN(C1)CC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)