CAS 2307299-92-7 is the registry number for 4-Bromo-n-(n,n-dimethylsulfamoyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-N-(dimethylsulfamoyl)benzamide (CAS 2307299-92-7) is a chemical compound with the molecular formula C9H11BrN2O3S and a molecular weight of 307.17 g/mol. IUPAC name: 4-bromo-N-(dimethylsulfamoyl)benzamide. InChIKey: GILGBCCJWNVDAW-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O3S |
|---|---|
| Molecular weight | 307.17 g/mol |
| IUPAC name | 4-bromo-N-(dimethylsulfamoyl)benzamide |
| InChIKey | GILGBCCJWNVDAW-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)NC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)