CAS 2307473-13-6 is the registry number for 2-(2-((4-(tert-Butyl)phenyl)sulfinyl)phenyl)-4-phenyl-4,5-dihydrooxazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(4-tert-butylphenyl)sulfinylphenyl]-4-phenyl-4,5-dihydro-1,3-oxazole (CAS 2307473-13-6) is a chemical compound with the molecular formula C25H25NO2S and a molecular weight of 403.5 g/mol. IUPAC name: 2-[2-(4-tert-butylphenyl)sulfinylphenyl]-4-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: ZIDRZTBFZIWXMW-UHFFFAOYSA-N.
| Molecular formula | C25H25NO2S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | 2-[2-(4-tert-butylphenyl)sulfinylphenyl]-4-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | ZIDRZTBFZIWXMW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)C2=CC=CC=C2C3=NC(CO3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)