Products 2307752-04-9
CAS 2307752-04-9 is the registry number for rac-(3R,4S)-4-cyclopropylpyrrolidin-3-ol hydrochloride, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3S,4R)-4-cyclopropylpyrrolidin-3-ol;hydrochloride (CAS 2307752-04-9) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (3S,4R)-4-cyclopropylpyrrolidin-3-ol;hydrochloride. InChIKey: KJUJFGYBOKALLR-UOERWJHTSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (3S,4R)-4-cyclopropylpyrrolidin-3-ol;hydrochloride |
| InChIKey | KJUJFGYBOKALLR-UOERWJHTSA-N |
| SMILES | C1CC1[C@@H]2CNC[C@H]2O.Cl |
Computed by PubChem (NCBI)