CAS 2307778-23-8 is the registry number for Rel-(1R,2R)-2-(trifluoromethyl)cyclobutan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-2-(trifluoromethyl)cyclobutan-1-amine (CAS 2307778-23-8) is a chemical compound with the molecular formula C5H8F3N and a molecular weight of 139.12 g/mol. IUPAC name: trans-(1R,2R)-2-(trifluoromethyl)cyclobutan-1-amine. InChIKey: MEOSMVOYORVSJA-QWWZWVQMSA-N.
| Molecular formula | C5H8F3N |
|---|---|
| Molecular weight | 139.12 g/mol |
| IUPAC name | trans-(1R,2R)-2-(trifluoromethyl)cyclobutan-1-amine |
| InChIKey | MEOSMVOYORVSJA-QWWZWVQMSA-N |
| SMILES | C1C[C@H]([C@@H]1C(F)(F)F)N |
Computed by PubChem (NCBI)