CAS 2307778-85-2 is the registry number for Rel-(3aS,6aR)-2-benzyl-3a-methyloctahydropyrrolo(3,4-c)pyrrole, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g, 1g.
(3aS,6aR)-5-benzyl-3a-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (CAS 2307778-85-2) is a chemical compound with the molecular formula C14H20N2 and a molecular weight of 216.32 g/mol. IUPAC name: (3aS,6aR)-5-benzyl-3a-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole. InChIKey: AESYNSJGQAAOOB-KGLIPLIRSA-N.
| Molecular formula | C14H20N2 |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | (3aS,6aR)-5-benzyl-3a-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| InChIKey | AESYNSJGQAAOOB-KGLIPLIRSA-N |
| SMILES | C[C@@]12CNC[C@@H]1CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)