CAS 2307784-40-1 is the registry number for Rel-tert-butyl ((3R,4S)-4-(1-methyl-1H-pyrazol-5-yl)pyrrolidin-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3S,4R)-4-(2-methylpyrazol-3-yl)pyrrolidin-3-yl]carbamate (CAS 2307784-40-1) is a chemical compound with the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. IUPAC name: tert-butyl N-[(3S,4R)-4-(2-methylpyrazol-3-yl)pyrrolidin-3-yl]carbamate. InChIKey: CUZGVSADDYEPFX-NXEZZACHSA-N.
| Molecular formula | C13H22N4O2 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | tert-butyl N-[(3S,4R)-4-(2-methylpyrazol-3-yl)pyrrolidin-3-yl]carbamate |
| InChIKey | CUZGVSADDYEPFX-NXEZZACHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNC[C@H]1C2=CC=NN2C |
Computed by PubChem (NCBI)