CAS 2307785-07-3 is the registry number for (R)- Niraparib Tosylate. Offered by: TRC. Available pack sizes: 25mg.
4-methylbenzenesulfonic acid;2-[4-[(3R)-piperidin-3-yl]phenyl]indazole-7-carboxamide (CAS 2307785-07-3) is a chemical compound with the molecular formula C26H28N4O4S and a molecular weight of 492.6 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;2-[4-[(3R)-piperidin-3-yl]phenyl]indazole-7-carboxamide. InChIKey: LCPFHXWLJMNKNC-UQKRIMTDSA-N.
| Molecular formula | C26H28N4O4S |
|---|---|
| Molecular weight | 492.6 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;2-[4-[(3R)-piperidin-3-yl]phenyl]indazole-7-carboxamide |
| InChIKey | LCPFHXWLJMNKNC-UQKRIMTDSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1C[C@@H](CNC1)C2=CC=C(C=C2)N3C=C4C=CC=C(C4=N3)C(=O)N |
Computed by PubChem (NCBI)