CAS 2308-61-4 appears in our catalog under these names: Bortezomib Impurity 67, 3,6-Dibenzylpiperazine-2,5-dione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
3,6-dibenzylpiperazine-2,5-dione (CAS 2308-61-4) is a chemical compound with the molecular formula C18H18N2O2 and a molecular weight of 294.3 g/mol. IUPAC name: 3,6-dibenzylpiperazine-2,5-dione. InChIKey: JUAPMRSLDANLAS-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O2 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 3,6-dibenzylpiperazine-2,5-dione |
| InChIKey | JUAPMRSLDANLAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2C(=O)NC(C(=O)N2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)