Products 2309456-89-9

CAS 2309456-89-9 is the registry number for Bis(4,6-dimethyl-1,2-dihydropyrimidin-2-one) sulfuric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Bis(4,6-dimethyl-1H-pyrimidin-2-one);sulfuric acid (CAS 2309456-89-9) is a chemical compound with the molecular formula C12H18N4O6S and a molecular weight of 346.36 g/mol. IUPAC name: bis(4,6-dimethyl-1H-pyrimidin-2-one);sulfuric acid. InChIKey: NOJRCLBULZHVMH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18N4O6S
Molecular weight346.36 g/mol
IUPAC namebis(4,6-dimethyl-1H-pyrimidin-2-one);sulfuric acid
InChIKeyNOJRCLBULZHVMH-UHFFFAOYSA-N
SMILESCC1=CC(=NC(=O)N1)C.CC1=CC(=NC(=O)N1)C.OS(=O)(=O)O

Computed by PubChem (NCBI)