CAS 2309463-06-5 is the registry number for 2-Chloro-4-(3-(trifluoromethyl)phenyl)quinazoline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-4-[3-(trifluoromethyl)phenyl]quinazoline (CAS 2309463-06-5) is a chemical compound with the molecular formula C15H8ClF3N2 and a molecular weight of 308.68 g/mol. IUPAC name: 2-chloro-4-[3-(trifluoromethyl)phenyl]quinazoline. InChIKey: BCBNIFLIUIPTKR-UHFFFAOYSA-N.
| Molecular formula | C15H8ClF3N2 |
|---|---|
| Molecular weight | 308.68 g/mol |
| IUPAC name | 2-chloro-4-[3-(trifluoromethyl)phenyl]quinazoline |
| InChIKey | BCBNIFLIUIPTKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)Cl)C3=CC(=CC=C3)C(F)(F)F |
Computed by PubChem (NCBI)