Products 2309473-90-1

CAS 2309473-90-1 is the registry number for 2-(2-Azabicyclo[2.2.1]heptan-2-yl)acetic acid hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(2-azabicyclo[2.2.1]heptan-2-yl)acetic acid;hydrobromide (CAS 2309473-90-1) is a chemical compound with the molecular formula C8H14BrNO2 and a molecular weight of 236.11 g/mol. IUPAC name: 2-(2-azabicyclo[2.2.1]heptan-2-yl)acetic acid;hydrobromide. InChIKey: MWWLNHRYJOLRPC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14BrNO2
Molecular weight236.11 g/mol
IUPAC name2-(2-azabicyclo[2.2.1]heptan-2-yl)acetic acid;hydrobromide
InChIKeyMWWLNHRYJOLRPC-UHFFFAOYSA-N
SMILESC1CC2CC1CN2CC(=O)O.Br

Computed by PubChem (NCBI)