CAS 23096-83-5 appears in our catalog under these names: 8-Ethyl-4-hydroxyquinoline, 95%, 8-Ethylquinolin-4-ol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
8-ethyl-1H-quinolin-4-one (CAS 23096-83-5) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 8-ethyl-1H-quinolin-4-one. InChIKey: YBQQVKSIRLQGQW-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 8-ethyl-1H-quinolin-4-one |
| InChIKey | YBQQVKSIRLQGQW-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C(=O)C=CN2 |
Computed by PubChem (NCBI)