CAS 230975-30-1 appears in our catalog under these names: Metoprolol Impurity 6, Metoprolol Bis Propanol, Metoprolol Impurity 5, Metoprolol Impurity 13, 1,3-Bis(4-(2-methoxyethyl)phenoxy)propan-2-ol, 98%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
1,3-bis[4-(2-methoxyethyl)phenoxy]propan-2-ol (CAS 230975-30-1) is a chemical compound with the molecular formula C21H28O5 and a molecular weight of 360.4 g/mol. IUPAC name: 1,3-bis[4-(2-methoxyethyl)phenoxy]propan-2-ol. InChIKey: JHRIEMFHIZBBOY-UHFFFAOYSA-N.
| Molecular formula | C21H28O5 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 1,3-bis[4-(2-methoxyethyl)phenoxy]propan-2-ol |
| InChIKey | JHRIEMFHIZBBOY-UHFFFAOYSA-N |
| SMILES | COCCC1=CC=C(C=C1)OCC(COC2=CC=C(C=C2)CCOC)O |
Computed by PubChem (NCBI)