CAS 23110-55-6 is the registry number for Bis(8-oxyquinoline) palladium (II), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Palladium(2+);bis(quinolin-8-olate) (CAS 23110-55-6) is a chemical compound with the molecular formula C18H12N2O2Pd and a molecular weight of 394.7 g/mol. IUPAC name: palladium(2+);bis(quinolin-8-olate). InChIKey: LQWYGAYGGJZQAX-UHFFFAOYSA-L.
| Molecular formula | C18H12N2O2Pd |
|---|---|
| Molecular weight | 394.7 g/mol |
| IUPAC name | palladium(2+);bis(quinolin-8-olate) |
| InChIKey | LQWYGAYGGJZQAX-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C(=C1)[O-])N=CC=C2.C1=CC2=C(C(=C1)[O-])N=CC=C2.[Pd+2] |
Computed by PubChem (NCBI)