CAS 23115-90-4 is the registry number for Ethyl 3-hydroxy-3-(perfluorophenyl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate (CAS 23115-90-4) is a chemical compound with the molecular formula C11H9F5O3 and a molecular weight of 284.18 g/mol. IUPAC name: ethyl 3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate. InChIKey: BVIUJBDWUGVDPA-UHFFFAOYSA-N.
| Molecular formula | C11H9F5O3 |
|---|---|
| Molecular weight | 284.18 g/mol |
| IUPAC name | ethyl 3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate |
| InChIKey | BVIUJBDWUGVDPA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=C(C(=C(C(=C1F)F)F)F)F)O |
Computed by PubChem (NCBI)