CAS 23124-11-0 is the registry number for 9-(3-Aminopropyl)-9H-purin-6-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
9-(3-aminopropyl)purin-6-amine;dihydrochloride (CAS 23124-11-0) is a chemical compound with the molecular formula C8H14Cl2N6 and a molecular weight of 265.14 g/mol. IUPAC name: 9-(3-aminopropyl)purin-6-amine;dihydrochloride. InChIKey: JBHTVQSBCOWVDK-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N6 |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | 9-(3-aminopropyl)purin-6-amine;dihydrochloride |
| InChIKey | JBHTVQSBCOWVDK-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)CCCN)N.Cl.Cl |
Computed by PubChem (NCBI)