CAS 231283-82-2 appears in our catalog under these names: Donepezil EP Impurity E Bromide, Donepezil Impurity 22, Donepezil Impurity 5, 1-Benzyl-4-(5,6-dimethoxy-1-oxoindan-2-yl)methylpyridinium Bromide. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 500mg, Get quote.
2-[(1-benzylpyridin-1-ium-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one bromide (CAS 231283-82-2) is a chemical compound with the molecular formula C24H24BrNO3 and a molecular weight of 454.4 g/mol. IUPAC name: 2-[(1-benzylpyridin-1-ium-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one bromide. InChIKey: SJDPCJIYDYUWEN-UHFFFAOYSA-M.
| Molecular formula | C24H24BrNO3 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | 2-[(1-benzylpyridin-1-ium-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one bromide |
| InChIKey | SJDPCJIYDYUWEN-UHFFFAOYSA-M |
| SMILES | COC1=C(C=C2C(=C1)CC(C2=O)CC3=CC=[N+](C=C3)CC4=CC=CC=C4)OC.[Br-] |
Computed by PubChem (NCBI)