CAS 23130-31-6 is the registry number for Guibourtinidin chloride. Offered by: GLPBio. Available pack sizes: 5mg.
2-(4-hydroxyphenyl)chromenylium-3,7-diol (CAS 23130-31-6) is a chemical compound with the molecular formula C15H11O4+ and a molecular weight of 255.24 g/mol. IUPAC name: 2-(4-hydroxyphenyl)chromenylium-3,7-diol. InChIKey: ZGQPDIBIQDDUNF-UHFFFAOYSA-O.
| Molecular formula | C15H11O4+ |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)chromenylium-3,7-diol |
| InChIKey | ZGQPDIBIQDDUNF-UHFFFAOYSA-O |
| SMILES | C1=CC(=CC=C1C2=C(C=C3C=CC(=CC3=[O+]2)O)O)O |
Computed by PubChem (NCBI)