CAS 23141-82-4 appears in our catalog under these names: Hydrochlorothiazide Impurity 4, Hydrochlorothiazide Impurity 11, 7-Sulfamoyl-3,4-dihydro-1,2,4-benzothiadiazine 1,1-dioxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide (CAS 23141-82-4) is a chemical compound with the molecular formula C7H9N3O4S2 and a molecular weight of 263.3 g/mol. IUPAC name: 1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide. InChIKey: BFUXUGOZJVHVMR-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4S2 |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | 1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChIKey | BFUXUGOZJVHVMR-UHFFFAOYSA-N |
| SMILES | C1NC2=C(C=C(C=C2)S(=O)(=O)N)S(=O)(=O)N1 |
Computed by PubChem (NCBI)