CAS 23145-92-8 is the registry number for 1-(3-Chlorobenzyl)piperazine dihydrochloride hydrate. Offered by: Biosynth. Available pack sizes: 25g.
1-[(3-chlorophenyl)methyl]piperazine;dihydrochloride (CAS 23145-92-8) is a chemical compound with the molecular formula C11H17Cl3N2 and a molecular weight of 283.6 g/mol. IUPAC name: 1-[(3-chlorophenyl)methyl]piperazine;dihydrochloride. InChIKey: QIDRCPGKNNJVJM-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl3N2 |
|---|---|
| Molecular weight | 283.6 g/mol |
| IUPAC name | 1-[(3-chlorophenyl)methyl]piperazine;dihydrochloride |
| InChIKey | QIDRCPGKNNJVJM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC(=CC=C2)Cl.Cl.Cl |
Computed by PubChem (NCBI)