Products 2314521-35-0

CAS 2314521-35-0 is the registry number for 2-Amino-3,6-dimethylbenzo[d]thiazol-3-ium iodide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3,6-dimethyl-1,3-benzothiazol-3-ium-2-amine iodide (CAS 2314521-35-0) is a chemical compound with the molecular formula C9H11IN2S and a molecular weight of 306.17 g/mol. IUPAC name: 3,6-dimethyl-1,3-benzothiazol-3-ium-2-amine iodide. InChIKey: LNMFVKRASKPXJI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11IN2S
Molecular weight306.17 g/mol
IUPAC name3,6-dimethyl-1,3-benzothiazol-3-ium-2-amine iodide
InChIKeyLNMFVKRASKPXJI-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)[N+](=C(S2)N)C.[I-]

Computed by PubChem (NCBI)