CAS 2314521-35-0 is the registry number for 2-Amino-3,6-dimethylbenzo[d]thiazol-3-ium iodide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dimethyl-1,3-benzothiazol-3-ium-2-amine iodide (CAS 2314521-35-0) is a chemical compound with the molecular formula C9H11IN2S and a molecular weight of 306.17 g/mol. IUPAC name: 3,6-dimethyl-1,3-benzothiazol-3-ium-2-amine iodide. InChIKey: LNMFVKRASKPXJI-UHFFFAOYSA-N.
| Molecular formula | C9H11IN2S |
|---|---|
| Molecular weight | 306.17 g/mol |
| IUPAC name | 3,6-dimethyl-1,3-benzothiazol-3-ium-2-amine iodide |
| InChIKey | LNMFVKRASKPXJI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)[N+](=C(S2)N)C.[I-] |
Computed by PubChem (NCBI)